C21H13F2N3O — CID 50798209
N-(2,5-difluorophenyl)-2-pyridin-2-ylquinoline-4-carboxamide (PubChem CID 50798209) has the molecular formula C21H13F2N3O and a molecular weight of 361.35 g/mol. Its IUPAC name is N-(2,5-difluorophenyl)-2-pyridin-2-ylquinoline-4-carboxamide.
| Compound Name | N-(2,5-difluorophenyl)-2-pyridin-2-ylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 50798209 |
| Molecular Formula | C21H13F2N3O |
| Molecular Weight | 361.35 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | N-(2,5-difluorophenyl)-2-pyridin-2-ylquinoline-4-carboxamide |
| SMILES | O=C(Nc1cc(F)ccc1F)c1cc(-c2ccccn2)nc2ccccc12 |
| InChI | InChI=1S/C21H13F2N3O/c22-13-8-9-16(23)19(11-13)26-21(27)15-12-20(18-7-3-4-10-24-18)25-17-6-2-1-5-14(15)17/h1-12H,(H,26,27) |
| InChIKey | GDGVOLJCOAXQJG-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.35 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |