C22H20N2O5S2 — CID 50800263
N-(3-benzyl-2-oxo-1,3-benzothiazol-6-yl)-2,5-dimethoxybenzenesulfonamide (PubChem CID 50800263) has the molecular formula C22H20N2O5S2 and a molecular weight of 456.55 g/mol. Its IUPAC name is N-(3-benzyl-2-oxo-1,3-benzothiazol-6-yl)-2,5-dimethoxybenzenesulfonamide.
| Compound Name | N-(3-benzyl-2-oxo-1,3-benzothiazol-6-yl)-2,5-dimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 50800263 |
| Molecular Formula | C22H20N2O5S2 |
| Molecular Weight | 456.55 g/mol |
| Exact Mass | 456.08 |
| IUPAC Name | N-(3-benzyl-2-oxo-1,3-benzothiazol-6-yl)-2,5-dimethoxybenzenesulfonamide |
| SMILES | COc1ccc(OC)c(S(=O)(=O)Nc2ccc3c(c2)sc(=O)n3Cc2ccccc2)c1 |
| InChI | InChI=1S/C22H20N2O5S2/c1-28-17-9-11-19(29-2)21(13-17)31(26,27)23-16-8-10-18-20(12-16)30-22(25)24(18)14-15-6-4-3-5-7-15/h3-13,23H,14H2,1-2H3 |
| InChIKey | MIUPRHZZBRHKLG-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.55 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |