C17H19N5 — CID 50800623
N-(2,4-dimethylphenyl)-11-methyl-1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine (PubChem CID 50800623) has the molecular formula C17H19N5 and a molecular weight of 293.37 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-11-methyl-1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine.
| Compound Name | N-(2,4-dimethylphenyl)-11-methyl-1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine |
|---|---|
| PubChem CID | 50800623 |
| Molecular Formula | C17H19N5 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | N-(2,4-dimethylphenyl)-11-methyl-1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine |
| SMILES | Cc1ccc(Nc2c3c(nc4nc(C)nn24)CCC3)c(C)c1 |
| InChI | InChI=1S/C17H19N5/c1-10-7-8-14(11(2)9-10)19-16-13-5-4-6-15(13)20-17-18-12(3)21-22(16)17/h7-9,19H,4-6H2,1-3H3 |
| InChIKey | HJFHRCJLVKCWLL-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |