C24H23FN4O — CID 50801401
1-(3-fluoro-4-methylphenyl)-3-[2-(1-methylindol-3-yl)-2-pyridin-3-ylethyl]urea (PubChem CID 50801401) has the molecular formula C24H23FN4O and a molecular weight of 402.47 g/mol. Its IUPAC name is 1-(3-fluoro-4-methylphenyl)-3-[2-(1-methylindol-3-yl)-2-pyridin-3-ylethyl]urea.
| Compound Name | 1-(3-fluoro-4-methylphenyl)-3-[2-(1-methylindol-3-yl)-2-pyridin-3-ylethyl]urea |
|---|---|
| PubChem CID | 50801401 |
| Molecular Formula | C24H23FN4O |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | 1-(3-fluoro-4-methylphenyl)-3-[2-(1-methylindol-3-yl)-2-pyridin-3-ylethyl]urea |
| SMILES | Cc1ccc(NC(=O)NCC(c2cccnc2)c2cn(C)c3ccccc23)cc1F |
| InChI | InChI=1S/C24H23FN4O/c1-16-9-10-18(12-22(16)25)28-24(30)27-14-20(17-6-5-11-26-13-17)21-15-29(2)23-8-4-3-7-19(21)23/h3-13,15,20H,14H2,1-2H3,(H2,27,28,30) |
| InChIKey | RQAGXNLEJHPNMK-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |