C23H21ClN4O — CID 50801418
1-(2-chlorophenyl)-3-[2-(1-methylindol-3-yl)-2-pyridin-3-ylethyl]urea (PubChem CID 50801418) has the molecular formula C23H21ClN4O and a molecular weight of 404.90 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-3-[2-(1-methylindol-3-yl)-2-pyridin-3-ylethyl]urea.
| Compound Name | 1-(2-chlorophenyl)-3-[2-(1-methylindol-3-yl)-2-pyridin-3-ylethyl]urea |
|---|---|
| PubChem CID | 50801418 |
| Molecular Formula | C23H21ClN4O |
| Molecular Weight | 404.90 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | 1-(2-chlorophenyl)-3-[2-(1-methylindol-3-yl)-2-pyridin-3-ylethyl]urea |
| SMILES | Cn1cc(C(CNC(=O)Nc2ccccc2Cl)c2cccnc2)c2ccccc21 |
| InChI | InChI=1S/C23H21ClN4O/c1-28-15-19(17-8-2-5-11-22(17)28)18(16-7-6-12-25-13-16)14-26-23(29)27-21-10-4-3-9-20(21)24/h2-13,15,18H,14H2,1H3,(H2,26,27,29) |
| InChIKey | AHXWYHXMQVUKFD-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.90 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |