C23H30N4O — CID 92876056
1-[(2S)-2-(1-ethylindol-3-yl)-2-pyridin-3-ylethyl]-3-(3-methylbutyl)urea (PubChem CID 92876056) has the molecular formula C23H30N4O and a molecular weight of 378.52 g/mol. Its IUPAC name is 1-[(2S)-2-(1-ethylindol-3-yl)-2-pyridin-3-ylethyl]-3-(3-methylbutyl)urea.
| Compound Name | 1-[(2S)-2-(1-ethylindol-3-yl)-2-pyridin-3-ylethyl]-3-(3-methylbutyl)urea |
|---|---|
| PubChem CID | 92876056 |
| Molecular Formula | C23H30N4O |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | 1-[(2S)-2-(1-ethylindol-3-yl)-2-pyridin-3-ylethyl]-3-(3-methylbutyl)urea |
| SMILES | CCn1cc([C@@H](CNC(=O)NCCC(C)C)c2cccnc2)c2ccccc21 |
| InChI | InChI=1S/C23H30N4O/c1-4-27-16-21(19-9-5-6-10-22(19)27)20(18-8-7-12-24-14-18)15-26-23(28)25-13-11-17(2)3/h5-10,12,14,16-17,20H,4,11,13,15H2,1-3H3,(H2,25,26,28)/t20-/m0/s1 |
| InChIKey | LNWHMRLOYBEDMI-FQEVSTJZSA-N |
| XLogP | 4.53 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |