C24H25N5O — CID 50801594
N-[(2-methoxyphenyl)methyl]-11-[(4-methylphenyl)methyl]-1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine (PubChem CID 50801594) has the molecular formula C24H25N5O and a molecular weight of 399.50 g/mol. Its IUPAC name is N-[(2-methoxyphenyl)methyl]-11-[(4-methylphenyl)methyl]-1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine.
| Compound Name | N-[(2-methoxyphenyl)methyl]-11-[(4-methylphenyl)methyl]-1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine |
|---|---|
| PubChem CID | 50801594 |
| Molecular Formula | C24H25N5O |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.21 |
| IUPAC Name | N-[(2-methoxyphenyl)methyl]-11-[(4-methylphenyl)methyl]-1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine |
| SMILES | COc1ccccc1CNc1c2c(nc3nc(Cc4ccc(C)cc4)nn13)CCC2 |
| InChI | InChI=1S/C24H25N5O/c1-16-10-12-17(13-11-16)14-22-27-24-26-20-8-5-7-19(20)23(29(24)28-22)25-15-18-6-3-4-9-21(18)30-2/h3-4,6,9-13,25H,5,7-8,14-15H2,1-2H3 |
| InChIKey | DNHPEUFMWUTURL-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 64.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |