C21H18BrN5O — CID 50819152
1-benzyl-N-[(3-bromophenyl)methyl]-5-pyrrol-1-yltriazole-4-carboxamide (PubChem CID 50819152) has the molecular formula C21H18BrN5O and a molecular weight of 436.31 g/mol. Its IUPAC name is 1-benzyl-N-[(3-bromophenyl)methyl]-5-pyrrol-1-yltriazole-4-carboxamide.
| Compound Name | 1-benzyl-N-[(3-bromophenyl)methyl]-5-pyrrol-1-yltriazole-4-carboxamide |
|---|---|
| PubChem CID | 50819152 |
| Molecular Formula | C21H18BrN5O |
| Molecular Weight | 436.31 g/mol |
| Exact Mass | 435.07 |
| IUPAC Name | 1-benzyl-N-[(3-bromophenyl)methyl]-5-pyrrol-1-yltriazole-4-carboxamide |
| SMILES | O=C(NCc1cccc(Br)c1)c1nnn(Cc2ccccc2)c1-n1cccc1 |
| InChI | InChI=1S/C21H18BrN5O/c22-18-10-6-9-17(13-18)14-23-20(28)19-21(26-11-4-5-12-26)27(25-24-19)15-16-7-2-1-3-8-16/h1-13H,14-15H2,(H,23,28) |
| InChIKey | KVYVCXBQJBSQGX-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.31 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |