C24H23ClN6O — CID 50819056
[1-[(3-chlorophenyl)methyl]-5-pyrrol-1-yltriazol-4-yl]-(4-phenylpiperazin-1-yl)methanone (PubChem CID 50819056) has the molecular formula C24H23ClN6O and a molecular weight of 446.94 g/mol. Its IUPAC name is [1-[(3-chlorophenyl)methyl]-5-pyrrol-1-yltriazol-4-yl]-(4-phenylpiperazin-1-yl)methanone.
| Compound Name | [1-[(3-chlorophenyl)methyl]-5-pyrrol-1-yltriazol-4-yl]-(4-phenylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 50819056 |
| Molecular Formula | C24H23ClN6O |
| Molecular Weight | 446.94 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | [1-[(3-chlorophenyl)methyl]-5-pyrrol-1-yltriazol-4-yl]-(4-phenylpiperazin-1-yl)methanone |
| SMILES | O=C(c1nnn(Cc2cccc(Cl)c2)c1-n1cccc1)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C24H23ClN6O/c25-20-8-6-7-19(17-20)18-31-23(29-11-4-5-12-29)22(26-27-31)24(32)30-15-13-28(14-16-30)21-9-2-1-3-10-21/h1-12,17H,13-16,18H2 |
| InChIKey | CRBUAMZRWZIKCY-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 59.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.94 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |