C23H22ClN5O — CID 95057320
1-[(3-chlorophenyl)methyl]-N-[(2R)-2-phenylpropyl]-5-pyrrol-1-yltriazole-4-carboxamide (PubChem CID 95057320) has the molecular formula C23H22ClN5O and a molecular weight of 419.92 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)methyl]-N-[(2R)-2-phenylpropyl]-5-pyrrol-1-yltriazole-4-carboxamide.
| Compound Name | 1-[(3-chlorophenyl)methyl]-N-[(2R)-2-phenylpropyl]-5-pyrrol-1-yltriazole-4-carboxamide |
|---|---|
| PubChem CID | 95057320 |
| Molecular Formula | C23H22ClN5O |
| Molecular Weight | 419.92 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | 1-[(3-chlorophenyl)methyl]-N-[(2R)-2-phenylpropyl]-5-pyrrol-1-yltriazole-4-carboxamide |
| SMILES | C[C@@H](CNC(=O)c1nnn(Cc2cccc(Cl)c2)c1-n1cccc1)c1ccccc1 |
| InChI | InChI=1S/C23H22ClN5O/c1-17(19-9-3-2-4-10-19)15-25-22(30)21-23(28-12-5-6-13-28)29(27-26-21)16-18-8-7-11-20(24)14-18/h2-14,17H,15-16H2,1H3,(H,25,30)/t17-/m0/s1 |
| InChIKey | IMXDXJBGEUAVRO-KRWDZBQOSA-N |
| XLogP | 4.30 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.92 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |