C22H29N3OS — CID 50820392
N-[(4-ethylphenyl)methyl]-6-(2-piperidin-1-ylethylsulfanyl)pyridine-3-carboxamide (PubChem CID 50820392) has the molecular formula C22H29N3OS and a molecular weight of 383.56 g/mol. Its IUPAC name is N-[(4-ethylphenyl)methyl]-6-(2-piperidin-1-ylethylsulfanyl)pyridine-3-carboxamide.
| Compound Name | N-[(4-ethylphenyl)methyl]-6-(2-piperidin-1-ylethylsulfanyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 50820392 |
| Molecular Formula | C22H29N3OS |
| Molecular Weight | 383.56 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | N-[(4-ethylphenyl)methyl]-6-(2-piperidin-1-ylethylsulfanyl)pyridine-3-carboxamide |
| SMILES | CCc1ccc(CNC(=O)c2ccc(SCCN3CCCCC3)nc2)cc1 |
| InChI | InChI=1S/C22H29N3OS/c1-2-18-6-8-19(9-7-18)16-24-22(26)20-10-11-21(23-17-20)27-15-14-25-12-4-3-5-13-25/h6-11,17H,2-5,12-16H2,1H3,(H,24,26) |
| InChIKey | SCJNZBGSCYHKOB-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.56 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |