C24H24N4O4S2 — CID 50822112
5-[4-[4-(4-methoxyphenyl)piperazin-1-yl]sulfonyl-5-methylthiophen-2-yl]-3-phenyl-1,2,4-oxadiazole (PubChem CID 50822112) has the molecular formula C24H24N4O4S2 and a molecular weight of 496.61 g/mol. Its IUPAC name is 5-[4-[4-(4-methoxyphenyl)piperazin-1-yl]sulfonyl-5-methylthiophen-2-yl]-3-phenyl-1,2,4-oxadiazole.
| Compound Name | 5-[4-[4-(4-methoxyphenyl)piperazin-1-yl]sulfonyl-5-methylthiophen-2-yl]-3-phenyl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 50822112 |
| Molecular Formula | C24H24N4O4S2 |
| Molecular Weight | 496.61 g/mol |
| Exact Mass | 496.12 |
| IUPAC Name | 5-[4-[4-(4-methoxyphenyl)piperazin-1-yl]sulfonyl-5-methylthiophen-2-yl]-3-phenyl-1,2,4-oxadiazole |
| SMILES | COc1ccc(N2CCN(S(=O)(=O)c3cc(-c4nc(-c5ccccc5)no4)sc3C)CC2)cc1 |
| InChI | InChI=1S/C24H24N4O4S2/c1-17-22(16-21(33-17)24-25-23(26-32-24)18-6-4-3-5-7-18)34(29,30)28-14-12-27(13-15-28)19-8-10-20(31-2)11-9-19/h3-11,16H,12-15H2,1-2H3 |
| InChIKey | XUHFQXPNMFUQED-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 88.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.61 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|