C20H23N3O3S3 — CID 50835831
2-[4-[4-(4-methoxyphenyl)piperazin-1-yl]sulfonyl-5-methylthiophen-2-yl]-4-methyl-1,3-thiazole (PubChem CID 50835831) has the molecular formula C20H23N3O3S3 and a molecular weight of 449.62 g/mol. Its IUPAC name is 2-[4-[4-(4-methoxyphenyl)piperazin-1-yl]sulfonyl-5-methylthiophen-2-yl]-4-methyl-1,3-thiazole.
| Compound Name | 2-[4-[4-(4-methoxyphenyl)piperazin-1-yl]sulfonyl-5-methylthiophen-2-yl]-4-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 50835831 |
| Molecular Formula | C20H23N3O3S3 |
| Molecular Weight | 449.62 g/mol |
| Exact Mass | 449.09 |
| IUPAC Name | 2-[4-[4-(4-methoxyphenyl)piperazin-1-yl]sulfonyl-5-methylthiophen-2-yl]-4-methyl-1,3-thiazole |
| SMILES | COc1ccc(N2CCN(S(=O)(=O)c3cc(-c4nc(C)cs4)sc3C)CC2)cc1 |
| InChI | InChI=1S/C20H23N3O3S3/c1-14-13-27-20(21-14)18-12-19(15(2)28-18)29(24,25)23-10-8-22(9-11-23)16-4-6-17(26-3)7-5-16/h4-7,12-13H,8-11H2,1-3H3 |
| InChIKey | HRNMOLCJIINIOH-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.62 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|