C19H22N4O4S2 — CID 53041516
3-[4-[4-(4-methoxyphenyl)piperazin-1-yl]sulfonyl-5-methylthiophen-2-yl]-5-methyl-1,2,4-oxadiazole (PubChem CID 53041516) has the molecular formula C19H22N4O4S2 and a molecular weight of 434.54 g/mol. Its IUPAC name is 3-[4-[4-(4-methoxyphenyl)piperazin-1-yl]sulfonyl-5-methylthiophen-2-yl]-5-methyl-1,2,4-oxadiazole.
| Compound Name | 3-[4-[4-(4-methoxyphenyl)piperazin-1-yl]sulfonyl-5-methylthiophen-2-yl]-5-methyl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 53041516 |
| Molecular Formula | C19H22N4O4S2 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.11 |
| IUPAC Name | 3-[4-[4-(4-methoxyphenyl)piperazin-1-yl]sulfonyl-5-methylthiophen-2-yl]-5-methyl-1,2,4-oxadiazole |
| SMILES | COc1ccc(N2CCN(S(=O)(=O)c3cc(-c4noc(C)n4)sc3C)CC2)cc1 |
| InChI | InChI=1S/C19H22N4O4S2/c1-13-18(12-17(28-13)19-20-14(2)27-21-19)29(24,25)23-10-8-22(9-11-23)15-4-6-16(26-3)7-5-15/h4-7,12H,8-11H2,1-3H3 |
| InChIKey | DNLVZRDBIINLND-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 88.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|