C21H25N3O4S — CID 50824359
N-(6-butylsulfonyl-1,3-dimethyl-2-oxobenzimidazol-5-yl)-2-methylbenzamide (PubChem CID 50824359) has the molecular formula C21H25N3O4S and a molecular weight of 415.52 g/mol. Its IUPAC name is N-(6-butylsulfonyl-1,3-dimethyl-2-oxobenzimidazol-5-yl)-2-methylbenzamide.
| Compound Name | N-(6-butylsulfonyl-1,3-dimethyl-2-oxobenzimidazol-5-yl)-2-methylbenzamide |
|---|---|
| PubChem CID | 50824359 |
| Molecular Formula | C21H25N3O4S |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | N-(6-butylsulfonyl-1,3-dimethyl-2-oxobenzimidazol-5-yl)-2-methylbenzamide |
| SMILES | CCCCS(=O)(=O)c1cc2c(cc1NC(=O)c1ccccc1C)n(C)c(=O)n2C |
| InChI | InChI=1S/C21H25N3O4S/c1-5-6-11-29(27,28)19-13-18-17(23(3)21(26)24(18)4)12-16(19)22-20(25)15-10-8-7-9-14(15)2/h7-10,12-13H,5-6,11H2,1-4H3,(H,22,25) |
| InChIKey | MZFFRNWBHAYOBI-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 90.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |