C20H17Cl2NO — CID 5083003
(3,4-dichlorophenyl)-(2-pyrrolidin-1-yl-3H-inden-1-yl)methanone (PubChem CID 5083003) has the molecular formula C20H17Cl2NO and a molecular weight of 358.27 g/mol. Its IUPAC name is (3,4-dichlorophenyl)-(2-pyrrolidin-1-yl-3H-inden-1-yl)methanone.
| Compound Name | (3,4-dichlorophenyl)-(2-pyrrolidin-1-yl-3H-inden-1-yl)methanone |
|---|---|
| PubChem CID | 5083003 |
| Molecular Formula | C20H17Cl2NO |
| Molecular Weight | 358.27 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | (3,4-dichlorophenyl)-(2-pyrrolidin-1-yl-3H-inden-1-yl)methanone |
| SMILES | O=C(C1=C(N2CCCC2)Cc2ccccc21)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H17Cl2NO/c21-16-8-7-14(11-17(16)22)20(24)19-15-6-2-1-5-13(15)12-18(19)23-9-3-4-10-23/h1-2,5-8,11H,3-4,9-10,12H2 |
| InChIKey | OJVWFKHBXHTDIL-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.27 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_ene_B(4)', 'substructure': 'N/A'} |
|---|