C24H31N3O5S — CID 50831114
1-[4-[(2,4-dimethylphenyl)sulfonylamino]benzoyl]-N-(3-methoxypropyl)pyrrolidine-2-carboxamide (PubChem CID 50831114) has the molecular formula C24H31N3O5S and a molecular weight of 473.60 g/mol. Its IUPAC name is 1-[4-[(2,4-dimethylphenyl)sulfonylamino]benzoyl]-N-(3-methoxypropyl)pyrrolidine-2-carboxamide.
| Compound Name | 1-[4-[(2,4-dimethylphenyl)sulfonylamino]benzoyl]-N-(3-methoxypropyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 50831114 |
| Molecular Formula | C24H31N3O5S |
| Molecular Weight | 473.60 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | 1-[4-[(2,4-dimethylphenyl)sulfonylamino]benzoyl]-N-(3-methoxypropyl)pyrrolidine-2-carboxamide |
| SMILES | COCCCNC(=O)C1CCCN1C(=O)c1ccc(NS(=O)(=O)c2ccc(C)cc2C)cc1 |
| InChI | InChI=1S/C24H31N3O5S/c1-17-7-12-22(18(2)16-17)33(30,31)26-20-10-8-19(9-11-20)24(29)27-14-4-6-21(27)23(28)25-13-5-15-32-3/h7-12,16,21,26H,4-6,13-15H2,1-3H3,(H,25,28) |
| InChIKey | QGIMIHUCLQVUBK-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.60 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|