C21H28N6O — CID 50832893
N-butyl-3-(4-piperidin-1-yl-[1,2,4]triazolo[4,3-a]quinoxalin-1-yl)propanamide (PubChem CID 50832893) has the molecular formula C21H28N6O and a molecular weight of 380.50 g/mol. Its IUPAC name is N-butyl-3-(4-piperidin-1-yl-[1,2,4]triazolo[4,3-a]quinoxalin-1-yl)propanamide.
| Compound Name | N-butyl-3-(4-piperidin-1-yl-[1,2,4]triazolo[4,3-a]quinoxalin-1-yl)propanamide |
|---|---|
| PubChem CID | 50832893 |
| Molecular Formula | C21H28N6O |
| Molecular Weight | 380.50 g/mol |
| Exact Mass | 380.23 |
| IUPAC Name | N-butyl-3-(4-piperidin-1-yl-[1,2,4]triazolo[4,3-a]quinoxalin-1-yl)propanamide |
| SMILES | CCCCNC(=O)CCc1nnc2c(N3CCCCC3)nc3ccccc3n12 |
| InChI | InChI=1S/C21H28N6O/c1-2-3-13-22-19(28)12-11-18-24-25-21-20(26-14-7-4-8-15-26)23-16-9-5-6-10-17(16)27(18)21/h5-6,9-10H,2-4,7-8,11-15H2,1H3,(H,22,28) |
| InChIKey | WRSBEVDROIZEIJ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 75.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.50 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|