C22H23N5O2S — CID 50835617
2-(4-oxo-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,7,11(16)-tetraen-5-yl)-N-(4-propan-2-ylphenyl)acetamide (PubChem CID 50835617) has the molecular formula C22H23N5O2S and a molecular weight of 421.53 g/mol. Its IUPAC name is 2-(4-oxo-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,7,11(16)-tetraen-5-yl)-N-(4-propan-2-ylphenyl)acetamide.
| Compound Name | 2-(4-oxo-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,7,11(16)-tetraen-5-yl)-N-(4-propan-2-ylphenyl)acetamide |
|---|---|
| PubChem CID | 50835617 |
| Molecular Formula | C22H23N5O2S |
| Molecular Weight | 421.53 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | 2-(4-oxo-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,7,11(16)-tetraen-5-yl)-N-(4-propan-2-ylphenyl)acetamide |
| SMILES | CC(C)c1ccc(NC(=O)Cn2c(=O)nc3c4c5c(sc4ncn32)CCCC5)cc1 |
| InChI | InChI=1S/C22H23N5O2S/c1-13(2)14-7-9-15(10-8-14)24-18(28)11-26-22(29)25-20-19-16-5-3-4-6-17(16)30-21(19)23-12-27(20)26/h7-10,12-13H,3-6,11H2,1-2H3,(H,24,28) |
| InChIKey | ADTMDVLSUOJUEZ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 81.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.53 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |