C21H21N5O3S — CID 50835691
N-[(3-methoxyphenyl)methyl]-2-(4-oxo-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,7,11(16)-tetraen-5-yl)acetamide (PubChem CID 50835691) has the molecular formula C21H21N5O3S and a molecular weight of 423.50 g/mol. Its IUPAC name is N-[(3-methoxyphenyl)methyl]-2-(4-oxo-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,7,11(16)-tetraen-5-yl)acetamide.
| Compound Name | N-[(3-methoxyphenyl)methyl]-2-(4-oxo-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,7,11(16)-tetraen-5-yl)acetamide |
|---|---|
| PubChem CID | 50835691 |
| Molecular Formula | C21H21N5O3S |
| Molecular Weight | 423.50 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | N-[(3-methoxyphenyl)methyl]-2-(4-oxo-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,7,11(16)-tetraen-5-yl)acetamide |
| SMILES | COc1cccc(CNC(=O)Cn2c(=O)nc3c4c5c(sc4ncn32)CCCC5)c1 |
| InChI | InChI=1S/C21H21N5O3S/c1-29-14-6-4-5-13(9-14)10-22-17(27)11-25-21(28)24-19-18-15-7-2-3-8-16(15)30-20(18)23-12-26(19)25/h4-6,9,12H,2-3,7-8,10-11H2,1H3,(H,22,27) |
| InChIKey | GFZVVUMXXICWEI-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 90.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.50 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |