C19H22N4O3S2 — CID 50840769
3-(2-phenoxyethylsulfanyl)-8-piperidin-1-ylsulfonyl-[1,2,4]triazolo[4,3-a]pyridine (PubChem CID 50840769) has the molecular formula C19H22N4O3S2 and a molecular weight of 418.54 g/mol. Its IUPAC name is 3-(2-phenoxyethylsulfanyl)-8-piperidin-1-ylsulfonyl-[1,2,4]triazolo[4,3-a]pyridine.
| Compound Name | 3-(2-phenoxyethylsulfanyl)-8-piperidin-1-ylsulfonyl-[1,2,4]triazolo[4,3-a]pyridine |
|---|---|
| PubChem CID | 50840769 |
| Molecular Formula | C19H22N4O3S2 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | 3-(2-phenoxyethylsulfanyl)-8-piperidin-1-ylsulfonyl-[1,2,4]triazolo[4,3-a]pyridine |
| SMILES | O=S(=O)(c1cccn2c(SCCOc3ccccc3)nnc12)N1CCCCC1 |
| InChI | InChI=1S/C19H22N4O3S2/c24-28(25,22-11-5-2-6-12-22)17-10-7-13-23-18(17)20-21-19(23)27-15-14-26-16-8-3-1-4-9-16/h1,3-4,7-10,13H,2,5-6,11-12,14-15H2 |
| InChIKey | DTESTHGPBCFLDC-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 76.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|