C18H14F2N4O4 — CID 5084339
4-(2,6-difluorophenyl)-6-methyl-N-(4-nitrophenyl)-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxamide (PubChem CID 5084339) has the molecular formula C18H14F2N4O4 and a molecular weight of 388.33 g/mol. Its IUPAC name is 4-(2,6-difluorophenyl)-6-methyl-N-(4-nitrophenyl)-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxamide.
| Compound Name | 4-(2,6-difluorophenyl)-6-methyl-N-(4-nitrophenyl)-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 5084339 |
| Molecular Formula | C18H14F2N4O4 |
| Molecular Weight | 388.33 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | 4-(2,6-difluorophenyl)-6-methyl-N-(4-nitrophenyl)-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxamide |
| SMILES | CC1=C(C(=O)Nc2ccc([N+](=O)[O-])cc2)C(c2c(F)cccc2F)NC(=O)N1 |
| InChI | InChI=1S/C18H14F2N4O4/c1-9-14(17(25)22-10-5-7-11(8-6-10)24(27)28)16(23-18(26)21-9)15-12(19)3-2-4-13(15)20/h2-8,16H,1H3,(H,22,25)(H2,21,23,26) |
| InChIKey | QZIFNCDJFFBMHU-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.33 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|