C22H23N5O5 — CID 41072874
(4S)-6-methyl-4-(4-morpholin-4-ylphenyl)-N-(4-nitrophenyl)-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxamide (PubChem CID 41072874) has the molecular formula C22H23N5O5 and a molecular weight of 437.46 g/mol. Its IUPAC name is (4S)-6-methyl-4-(4-morpholin-4-ylphenyl)-N-(4-nitrophenyl)-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxamide.
| Compound Name | (4S)-6-methyl-4-(4-morpholin-4-ylphenyl)-N-(4-nitrophenyl)-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 41072874 |
| Molecular Formula | C22H23N5O5 |
| Molecular Weight | 437.46 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | (4S)-6-methyl-4-(4-morpholin-4-ylphenyl)-N-(4-nitrophenyl)-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxamide |
| SMILES | CC1=C(C(=O)Nc2ccc([N+](=O)[O-])cc2)[C@H](c2ccc(N3CCOCC3)cc2)NC(=O)N1 |
| InChI | InChI=1S/C22H23N5O5/c1-14-19(21(28)24-16-4-8-18(9-5-16)27(30)31)20(25-22(29)23-14)15-2-6-17(7-3-15)26-10-12-32-13-11-26/h2-9,20H,10-13H2,1H3,(H,24,28)(H2,23,25,29)/t20-/m0/s1 |
| InChIKey | OVCFSONYQABCHX-FQEVSTJZSA-N |
| XLogP | 2.70 |
| TPSA | 125.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.46 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|