C27H24N6O4 — CID 3941763
6-methyl-N-(4-nitrophenyl)-2-oxo-4-[4-(5-phenyl-3,4-dihydropyrazol-2-yl)phenyl]-3,4-dihydro-1H-pyrimidine-5-carboxamide (PubChem CID 3941763) has the molecular formula C27H24N6O4 and a molecular weight of 496.53 g/mol. Its IUPAC name is 6-methyl-N-(4-nitrophenyl)-2-oxo-4-[4-(5-phenyl-3,4-dihydropyrazol-2-yl)phenyl]-3,4-dihydro-1H-pyrimidine-5-carboxamide.
| Compound Name | 6-methyl-N-(4-nitrophenyl)-2-oxo-4-[4-(5-phenyl-3,4-dihydropyrazol-2-yl)phenyl]-3,4-dihydro-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 3941763 |
| Molecular Formula | C27H24N6O4 |
| Molecular Weight | 496.53 g/mol |
| Exact Mass | 496.19 |
| IUPAC Name | 6-methyl-N-(4-nitrophenyl)-2-oxo-4-[4-(5-phenyl-3,4-dihydropyrazol-2-yl)phenyl]-3,4-dihydro-1H-pyrimidine-5-carboxamide |
| SMILES | CC1=C(C(=O)Nc2ccc([N+](=O)[O-])cc2)C(c2ccc(N3CCC(c4ccccc4)=N3)cc2)NC(=O)N1 |
| InChI | InChI=1S/C27H24N6O4/c1-17-24(26(34)29-20-9-13-22(14-10-20)33(36)37)25(30-27(35)28-17)19-7-11-21(12-8-19)32-16-15-23(31-32)18-5-3-2-4-6-18/h2-14,25H,15-16H2,1H3,(H,29,34)(H2,28,30,35) |
| InChIKey | YMEUZGHGTCTCRN-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 128.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.53 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|