C21H24N4O2S — CID 50844707
N-benzyl-3-(4-oxo-2-piperidin-1-ylthieno[3,2-d]pyrimidin-3-yl)propanamide (PubChem CID 50844707) has the molecular formula C21H24N4O2S and a molecular weight of 396.52 g/mol. Its IUPAC name is N-benzyl-3-(4-oxo-2-piperidin-1-ylthieno[3,2-d]pyrimidin-3-yl)propanamide.
| Compound Name | N-benzyl-3-(4-oxo-2-piperidin-1-ylthieno[3,2-d]pyrimidin-3-yl)propanamide |
|---|---|
| PubChem CID | 50844707 |
| Molecular Formula | C21H24N4O2S |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | N-benzyl-3-(4-oxo-2-piperidin-1-ylthieno[3,2-d]pyrimidin-3-yl)propanamide |
| SMILES | O=C(CCn1c(N2CCCCC2)nc2ccsc2c1=O)NCc1ccccc1 |
| InChI | InChI=1S/C21H24N4O2S/c26-18(22-15-16-7-3-1-4-8-16)9-13-25-20(27)19-17(10-14-28-19)23-21(25)24-11-5-2-6-12-24/h1,3-4,7-8,10,14H,2,5-6,9,11-13,15H2,(H,22,26) |
| InChIKey | WSOPKUSHYGCMML-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |