C26H30N4O2 — CID 50848119
N-[1-(4-ethoxyphenyl)ethyl]-4-(3-piperidin-1-ylpyrazin-2-yl)benzamide (PubChem CID 50848119) has the molecular formula C26H30N4O2 and a molecular weight of 430.55 g/mol. Its IUPAC name is N-[1-(4-ethoxyphenyl)ethyl]-4-(3-piperidin-1-ylpyrazin-2-yl)benzamide.
| Compound Name | N-[1-(4-ethoxyphenyl)ethyl]-4-(3-piperidin-1-ylpyrazin-2-yl)benzamide |
|---|---|
| PubChem CID | 50848119 |
| Molecular Formula | C26H30N4O2 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | N-[1-(4-ethoxyphenyl)ethyl]-4-(3-piperidin-1-ylpyrazin-2-yl)benzamide |
| SMILES | CCOc1ccc(C(C)NC(=O)c2ccc(-c3nccnc3N3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C26H30N4O2/c1-3-32-23-13-11-20(12-14-23)19(2)29-26(31)22-9-7-21(8-10-22)24-25(28-16-15-27-24)30-17-5-4-6-18-30/h7-16,19H,3-6,17-18H2,1-2H3,(H,29,31) |
| InChIKey | LHQWKJMSLXLPFD-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |