C26H29N5O2 — CID 50848278
[4-(2-methoxyphenyl)piperazin-1-yl]-[4-(3-pyrrolidin-1-ylpyrazin-2-yl)phenyl]methanone (PubChem CID 50848278) has the molecular formula C26H29N5O2 and a molecular weight of 443.55 g/mol. Its IUPAC name is [4-(2-methoxyphenyl)piperazin-1-yl]-[4-(3-pyrrolidin-1-ylpyrazin-2-yl)phenyl]methanone.
| Compound Name | [4-(2-methoxyphenyl)piperazin-1-yl]-[4-(3-pyrrolidin-1-ylpyrazin-2-yl)phenyl]methanone |
|---|---|
| PubChem CID | 50848278 |
| Molecular Formula | C26H29N5O2 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.23 |
| IUPAC Name | [4-(2-methoxyphenyl)piperazin-1-yl]-[4-(3-pyrrolidin-1-ylpyrazin-2-yl)phenyl]methanone |
| SMILES | COc1ccccc1N1CCN(C(=O)c2ccc(-c3nccnc3N3CCCC3)cc2)CC1 |
| InChI | InChI=1S/C26H29N5O2/c1-33-23-7-3-2-6-22(23)29-16-18-31(19-17-29)26(32)21-10-8-20(9-11-21)24-25(28-13-12-27-24)30-14-4-5-15-30/h2-3,6-13H,4-5,14-19H2,1H3 |
| InChIKey | RMEGLAUUCKQOOL-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 61.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |