C22H25N3OS — CID 50854868
(5E)-5-[(1-cyclohexylpyrrol-3-yl)methylidene]-3-ethyl-2-phenylimino-1,3-thiazolidin-4-one (PubChem CID 50854868) has the molecular formula C22H25N3OS and a molecular weight of 379.53 g/mol. Its IUPAC name is (5E)-5-[(1-cyclohexylpyrrol-3-yl)methylidene]-3-ethyl-2-phenylimino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[(1-cyclohexylpyrrol-3-yl)methylidene]-3-ethyl-2-phenylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 50854868 |
| Molecular Formula | C22H25N3OS |
| Molecular Weight | 379.53 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | (5E)-5-[(1-cyclohexylpyrrol-3-yl)methylidene]-3-ethyl-2-phenylimino-1,3-thiazolidin-4-one |
| SMILES | CCN1C(=O)/C(=C\c2ccn(C3CCCCC3)c2)S/C1=N\c1ccccc1 |
| InChI | InChI=1S/C22H25N3OS/c1-2-25-21(26)20(27-22(25)23-18-9-5-3-6-10-18)15-17-13-14-24(16-17)19-11-7-4-8-12-19/h3,5-6,9-10,13-16,19H,2,4,7-8,11-12H2,1H3/b20-15+,23-22- |
| InChIKey | ZCTNPMXFTPOESQ-OCIPIQTLSA-N |
| XLogP | 5.62 |
| TPSA | 37.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.53 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|