C29H36N4O2S — CID 90671362
(5E)-5-benzylidene-3-[3-(4-cyclohexylpiperazin-1-yl)-2-hydroxypropyl]-2-phenylimino-1,3-thiazolidin-4-one (PubChem CID 90671362) has the molecular formula C29H36N4O2S and a molecular weight of 504.70 g/mol. Its IUPAC name is (5E)-5-benzylidene-3-[3-(4-cyclohexylpiperazin-1-yl)-2-hydroxypropyl]-2-phenylimino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-benzylidene-3-[3-(4-cyclohexylpiperazin-1-yl)-2-hydroxypropyl]-2-phenylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 90671362 |
| Molecular Formula | C29H36N4O2S |
| Molecular Weight | 504.70 g/mol |
| Exact Mass | 504.26 |
| IUPAC Name | (5E)-5-benzylidene-3-[3-(4-cyclohexylpiperazin-1-yl)-2-hydroxypropyl]-2-phenylimino-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C\c2ccccc2)S/C(=N\c2ccccc2)N1CC(O)CN1CCN(C2CCCCC2)CC1 |
| InChI | InChI=1S/C29H36N4O2S/c34-26(21-31-16-18-32(19-17-31)25-14-8-3-9-15-25)22-33-28(35)27(20-23-10-4-1-5-11-23)36-29(33)30-24-12-6-2-7-13-24/h1-2,4-7,10-13,20,25-26,34H,3,8-9,14-19,21-22H2/b27-20+,30-29- |
| InChIKey | SANBTOOACCJQFQ-GFYHBDFCSA-N |
| XLogP | 4.60 |
| TPSA | 59.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.70 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|