C24H26FN3O2 — CID 50858589
(5E)-3-[(2-fluorophenyl)methyl]-5-[(1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methylidene]imidazolidine-2,4-dione (PubChem CID 50858589) has the molecular formula C24H26FN3O2 and a molecular weight of 407.49 g/mol. Its IUPAC name is (5E)-3-[(2-fluorophenyl)methyl]-5-[(1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methylidene]imidazolidine-2,4-dione.
| Compound Name | (5E)-3-[(2-fluorophenyl)methyl]-5-[(1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methylidene]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 50858589 |
| Molecular Formula | C24H26FN3O2 |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | (5E)-3-[(2-fluorophenyl)methyl]-5-[(1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methylidene]imidazolidine-2,4-dione |
| SMILES | CC1CC(C)(C)N(C)c2ccc(/C=C3/NC(=O)N(Cc4ccccc4F)C3=O)cc21 |
| InChI | InChI=1S/C24H26FN3O2/c1-15-13-24(2,3)27(4)21-10-9-16(11-18(15)21)12-20-22(29)28(23(30)26-20)14-17-7-5-6-8-19(17)25/h5-12,15H,13-14H2,1-4H3,(H,26,30)/b20-12+ |
| InChIKey | SDUXGKGQOMJPCW-UDWIEESQSA-N |
| XLogP | 4.64 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|