C25H28FN3O2 — CID 132666681
(5Z)-5-[(1-ethyl-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)methylidene]-3-[(4-fluorophenyl)methyl]imidazolidine-2,4-dione (PubChem CID 132666681) has the molecular formula C25H28FN3O2 and a molecular weight of 421.52 g/mol. Its IUPAC name is (5Z)-5-[(1-ethyl-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)methylidene]-3-[(4-fluorophenyl)methyl]imidazolidine-2,4-dione.
| Compound Name | (5Z)-5-[(1-ethyl-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)methylidene]-3-[(4-fluorophenyl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 132666681 |
| Molecular Formula | C25H28FN3O2 |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.22 |
| IUPAC Name | (5Z)-5-[(1-ethyl-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)methylidene]-3-[(4-fluorophenyl)methyl]imidazolidine-2,4-dione |
| SMILES | CCN1c2ccc(/C=C3\NC(=O)N(Cc4ccc(F)cc4)C3=O)cc2C(C)CC1(C)C |
| InChI | InChI=1S/C25H28FN3O2/c1-5-29-22-11-8-18(12-20(22)16(2)14-25(29,3)4)13-21-23(30)28(24(31)27-21)15-17-6-9-19(26)10-7-17/h6-13,16H,5,14-15H2,1-4H3,(H,27,31)/b21-13- |
| InChIKey | WCZNYLNFLINVRB-BKUYFWCQSA-N |
| XLogP | 5.03 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|