C17H12N2O3 — CID 5085983
4-(1,3-benzodioxol-5-yldiazenyl)naphthalen-1-ol (PubChem CID 5085983) has the molecular formula C17H12N2O3 and a molecular weight of 292.29 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-yldiazenyl)naphthalen-1-ol.
| Compound Name | 4-(1,3-benzodioxol-5-yldiazenyl)naphthalen-1-ol |
|---|---|
| PubChem CID | 5085983 |
| Molecular Formula | C17H12N2O3 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | 4-(1,3-benzodioxol-5-yldiazenyl)naphthalen-1-ol |
| SMILES | Oc1ccc(/N=N/c2ccc3c(c2)OCO3)c2ccccc12 |
| InChI | InChI=1S/C17H12N2O3/c20-15-7-6-14(12-3-1-2-4-13(12)15)19-18-11-5-8-16-17(9-11)22-10-21-16/h1-9,20H,10H2/b19-18+ |
| InChIKey | LOXCGNHSKAQWAG-VHEBQXMUSA-N |
| XLogP | 4.69 |
| TPSA | 63.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|