C26H30N2O7 — CID 589171
1-(2,5,8,11,14,17-hexaoxabicyclo[16.4.0]docosa-1(18),19,21-trien-20-yldiazenyl)naphthalen-2-ol (PubChem CID 589171) has the molecular formula C26H30N2O7 and a molecular weight of 482.53 g/mol. Its IUPAC name is 1-(2,5,8,11,14,17-hexaoxabicyclo[16.4.0]docosa-1(18),19,21-trien-20-yldiazenyl)naphthalen-2-ol.
| Compound Name | 1-(2,5,8,11,14,17-hexaoxabicyclo[16.4.0]docosa-1(18),19,21-trien-20-yldiazenyl)naphthalen-2-ol |
|---|---|
| PubChem CID | 589171 |
| Molecular Formula | C26H30N2O7 |
| Molecular Weight | 482.53 g/mol |
| Exact Mass | 482.21 |
| IUPAC Name | 1-(2,5,8,11,14,17-hexaoxabicyclo[16.4.0]docosa-1(18),19,21-trien-20-yldiazenyl)naphthalen-2-ol |
| SMILES | Oc1ccc2ccccc2c1/N=N/c1ccc2c(c1)OCCOCCOCCOCCOCCO2 |
| InChI | InChI=1S/C26H30N2O7/c29-23-7-5-20-3-1-2-4-22(20)26(23)28-27-21-6-8-24-25(19-21)35-18-16-33-14-12-31-10-9-30-11-13-32-15-17-34-24/h1-8,19,29H,9-18H2/b28-27+ |
| InChIKey | UJJCWYXPBFITJL-BYYHNAKLSA-N |
| XLogP | 4.80 |
| TPSA | 100.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.53 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|