C19H19NO3 — CID 15684120
1-[(2-amino-4,5-dimethoxyphenyl)methyl]naphthalen-2-ol (PubChem CID 15684120) has the molecular formula C19H19NO3 and a molecular weight of 309.37 g/mol. Its IUPAC name is 1-[(2-amino-4,5-dimethoxyphenyl)methyl]naphthalen-2-ol.
| Compound Name | 1-[(2-amino-4,5-dimethoxyphenyl)methyl]naphthalen-2-ol |
|---|---|
| PubChem CID | 15684120 |
| Molecular Formula | C19H19NO3 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | 1-[(2-amino-4,5-dimethoxyphenyl)methyl]naphthalen-2-ol |
| SMILES | COc1cc(N)c(Cc2c(O)ccc3ccccc23)cc1OC |
| InChI | InChI=1S/C19H19NO3/c1-22-18-10-13(16(20)11-19(18)23-2)9-15-14-6-4-3-5-12(14)7-8-17(15)21/h3-8,10-11,21H,9,20H2,1-2H3 |
| InChIKey | VWUHNJXMMSTEFZ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|