C22H23Br2N3O3 — CID 50865756
3,5-dibromo-2-hydroxy-N-[(Z)-(7-methoxy-1,2,2,4-tetramethylquinolin-6-yl)methylideneamino]benzamide (PubChem CID 50865756) has the molecular formula C22H23Br2N3O3 and a molecular weight of 537.25 g/mol. Its IUPAC name is 3,5-dibromo-2-hydroxy-N-[(Z)-(7-methoxy-1,2,2,4-tetramethylquinolin-6-yl)methylideneamino]benzamide.
| Compound Name | 3,5-dibromo-2-hydroxy-N-[(Z)-(7-methoxy-1,2,2,4-tetramethylquinolin-6-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 50865756 |
| Molecular Formula | C22H23Br2N3O3 |
| Molecular Weight | 537.25 g/mol |
| Exact Mass | 535.01 |
| IUPAC Name | 3,5-dibromo-2-hydroxy-N-[(Z)-(7-methoxy-1,2,2,4-tetramethylquinolin-6-yl)methylideneamino]benzamide |
| SMILES | COc1cc2c(cc1/C=N\NC(=O)c1cc(Br)cc(Br)c1O)C(C)=CC(C)(C)N2C |
| InChI | InChI=1S/C22H23Br2N3O3/c1-12-10-22(2,3)27(4)18-9-19(30-5)13(6-15(12)18)11-25-26-21(29)16-7-14(23)8-17(24)20(16)28/h6-11,28H,1-5H3,(H,26,29)/b25-11- |
| InChIKey | SJIRVTQEDVAYLC-GATIEOLUSA-N |
| XLogP | 5.32 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.25 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|