C13H17N3OS2 — CID 50874016
2-[[2-[(2Z)-2-butan-2-ylidenehydrazinyl]-1,3-benzothiazol-6-yl]sulfanyl]ethanol (PubChem CID 50874016) has the molecular formula C13H17N3OS2 and a molecular weight of 295.43 g/mol. Its IUPAC name is 2-[[2-[(2Z)-2-butan-2-ylidenehydrazinyl]-1,3-benzothiazol-6-yl]sulfanyl]ethanol.
| Compound Name | 2-[[2-[(2Z)-2-butan-2-ylidenehydrazinyl]-1,3-benzothiazol-6-yl]sulfanyl]ethanol |
|---|---|
| PubChem CID | 50874016 |
| Molecular Formula | C13H17N3OS2 |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | 2-[[2-[(2Z)-2-butan-2-ylidenehydrazinyl]-1,3-benzothiazol-6-yl]sulfanyl]ethanol |
| SMILES | CC/C(C)=N\Nc1nc2ccc(SCCO)cc2s1 |
| InChI | InChI=1S/C13H17N3OS2/c1-3-9(2)15-16-13-14-11-5-4-10(18-7-6-17)8-12(11)19-13/h4-5,8,17H,3,6-7H2,1-2H3,(H,14,16)/b15-9- |
| InChIKey | XSVDZHPWCFGOMI-DHDCSXOGSA-N |
| XLogP | 3.58 |
| TPSA | 57.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|