C13H17ClN3O2S+ — CID 50876607
4-chloro-N-[3-(1H-imidazol-3-ium-3-yl)propyl]-3-methylbenzenesulfonamide (PubChem CID 50876607) has the molecular formula C13H17ClN3O2S+ and a molecular weight of 314.82 g/mol. Its IUPAC name is 4-chloro-N-[3-(1H-imidazol-3-ium-3-yl)propyl]-3-methylbenzenesulfonamide.
| Compound Name | 4-chloro-N-[3-(1H-imidazol-3-ium-3-yl)propyl]-3-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 50876607 |
| Molecular Formula | C13H17ClN3O2S+ |
| Molecular Weight | 314.82 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | 4-chloro-N-[3-(1H-imidazol-3-ium-3-yl)propyl]-3-methylbenzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NCCC[n+]2cc[nH]c2)ccc1Cl |
| InChI | InChI=1S/C13H16ClN3O2S/c1-11-9-12(3-4-13(11)14)20(18,19)16-5-2-7-17-8-6-15-10-17/h3-4,6,8-10,16H,2,5,7H2,1H3/p+1 |
| InChIKey | YTSOQXWGPBKCKI-UHFFFAOYSA-O |
| XLogP | 1.63 |
| TPSA | 65.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.82 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|