C20H20N2O4S — CID 50876974
benzyl N-[1-(1,3-dioxoisoindol-2-yl)-3-methylsulfanylpropyl]carbamate (PubChem CID 50876974) has the molecular formula C20H20N2O4S and a molecular weight of 384.46 g/mol. Its IUPAC name is benzyl N-[1-(1,3-dioxoisoindol-2-yl)-3-methylsulfanylpropyl]carbamate.
| Compound Name | benzyl N-[1-(1,3-dioxoisoindol-2-yl)-3-methylsulfanylpropyl]carbamate |
|---|---|
| PubChem CID | 50876974 |
| Molecular Formula | C20H20N2O4S |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | benzyl N-[1-(1,3-dioxoisoindol-2-yl)-3-methylsulfanylpropyl]carbamate |
| SMILES | CSCCC(NC(=O)OCc1ccccc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C20H20N2O4S/c1-27-12-11-17(21-20(25)26-13-14-7-3-2-4-8-14)22-18(23)15-9-5-6-10-16(15)19(22)24/h2-10,17H,11-13H2,1H3,(H,21,25) |
| InChIKey | MVMMFXKEEJPNTM-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|