C20H20N2O5 — CID 50877499
2-[[2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-3-phenylpropanoyl]amino]acetic acid (PubChem CID 50877499) has the molecular formula C20H20N2O5 and a molecular weight of 368.39 g/mol. Its IUPAC name is 2-[[2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-3-phenylpropanoyl]amino]acetic acid.
| Compound Name | 2-[[2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-3-phenylpropanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 50877499 |
| Molecular Formula | C20H20N2O5 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | 2-[[2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-3-phenylpropanoyl]amino]acetic acid |
| SMILES | O=C(O)CNC(=O)C(Cc1ccccc1)N1C(=O)C2C3C=CC(C3)C2C1=O |
| InChI | InChI=1S/C20H20N2O5/c23-15(24)10-21-18(25)14(8-11-4-2-1-3-5-11)22-19(26)16-12-6-7-13(9-12)17(16)20(22)27/h1-7,12-14,16-17H,8-10H2,(H,21,25)(H,23,24) |
| InChIKey | UOAOXSLHJNFQEE-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|