C21H22N2O5 — CID 50877574
3-[[2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-3-phenylpropanoyl]amino]propanoic acid (PubChem CID 50877574) has the molecular formula C21H22N2O5 and a molecular weight of 382.42 g/mol. Its IUPAC name is 3-[[2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-3-phenylpropanoyl]amino]propanoic acid.
| Compound Name | 3-[[2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-3-phenylpropanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 50877574 |
| Molecular Formula | C21H22N2O5 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | 3-[[2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-3-phenylpropanoyl]amino]propanoic acid |
| SMILES | O=C(O)CCNC(=O)C(Cc1ccccc1)N1C(=O)C2C3C=CC(C3)C2C1=O |
| InChI | InChI=1S/C21H22N2O5/c24-16(25)8-9-22-19(26)15(10-12-4-2-1-3-5-12)23-20(27)17-13-6-7-14(11-13)18(17)21(23)28/h1-7,13-15,17-18H,8-11H2,(H,22,26)(H,24,25) |
| InChIKey | BAMOXPIYCCYHCK-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|