About 8-chloro-1H-pyrazolo[4,3-c]quinolin-3-amine
8-chloro-1H-pyrazolo[4,3-c]quinolin-3-amine (PubChem CID 50877641) has the molecular formula C10H7ClN4
and a molecular weight of 218.65 g/mol. Its IUPAC name is 8-chloro-1H-pyrazolo[4,3-c]quinolin-3-amine.
Molecular Properties
| Compound Name | 8-chloro-1H-pyrazolo[4,3-c]quinolin-3-amine |
| PubChem CID | 50877641 |
| Molecular Formula | C10H7ClN4 |
| Molecular Weight | 218.65 g/mol |
| Exact Mass | 218.04 |
| IUPAC Name | 8-chloro-1H-pyrazolo[4,3-c]quinolin-3-amine |
| SMILES | Nc1n[nH]c2c1cnc1ccc(Cl)cc12 |
| InChI | InChI=1S/C10H7ClN4/c11-5-1-2-8-6(3-5)9-7(4-13-8)10(12)15-14-9/h1-4H,(H3,12,14,15) |
| InChIKey | RXBUOOREQRTOJY-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.65 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-chloro-1H-pyrazolo[4,3-c]quinolin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-chloro-1H-pyrazolo[4,3-c]quinolin-3-amine?
The IUPAC name of 8-chloro-1H-pyrazolo[4,3-c]quinolin-3-amine (CID 50877641) is 8-chloro-1H-pyrazolo[4,3-c]quinolin-3-amine.
What is the SMILES notation for 8-chloro-1H-pyrazolo[4,3-c]quinolin-3-amine?
The canonical SMILES for 8-chloro-1H-pyrazolo[4,3-c]quinolin-3-amine is Nc1n[nH]c2c1cnc1ccc(Cl)cc12.
What is the InChIKey of 8-chloro-1H-pyrazolo[4,3-c]quinolin-3-amine?
The InChIKey is RXBUOOREQRTOJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7ClN4/c11-5-1-2-8-6(3-5)9-7(4-13-8)10(12)15-14-9/h1-4H,(H3,12,14,15).
What are the key properties of 8-chloro-1H-pyrazolo[4,3-c]quinolin-3-amine?
8-chloro-1H-pyrazolo[4,3-c]quinolin-3-amine has a molecular weight of 218.65 g/mol, XLogP of 2.35, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-chloro-1H-pyrazolo[4,3-c]quinolin-3-amine is sourced from PubChem (CID 50877641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).