C18H16ClN4O2S+ — CID 50878204
4-N-[4-(4-chlorophenyl)-3-prop-2-enyl-1,3-thiazol-3-ium-2-yl]-2-nitrobenzene-1,4-diamine (PubChem CID 50878204) has the molecular formula C18H16ClN4O2S+ and a molecular weight of 387.87 g/mol. Its IUPAC name is 4-N-[4-(4-chlorophenyl)-3-prop-2-enyl-1,3-thiazol-3-ium-2-yl]-2-nitrobenzene-1,4-diamine.
| Compound Name | 4-N-[4-(4-chlorophenyl)-3-prop-2-enyl-1,3-thiazol-3-ium-2-yl]-2-nitrobenzene-1,4-diamine |
|---|---|
| PubChem CID | 50878204 |
| Molecular Formula | C18H16ClN4O2S+ |
| Molecular Weight | 387.87 g/mol |
| Exact Mass | 387.07 |
| IUPAC Name | 4-N-[4-(4-chlorophenyl)-3-prop-2-enyl-1,3-thiazol-3-ium-2-yl]-2-nitrobenzene-1,4-diamine |
| SMILES | C=CC[n+]1c(-c2ccc(Cl)cc2)csc1Nc1ccc(N)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H15ClN4O2S/c1-2-9-22-17(12-3-5-13(19)6-4-12)11-26-18(22)21-14-7-8-15(20)16(10-14)23(24)25/h2-8,10-11H,1,9,20H2/p+1 |
| InChIKey | ZFUPEEXJJMMTRE-UHFFFAOYSA-O |
| XLogP | 4.78 |
| TPSA | 85.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.87 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_D(8)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|