C19H19FN4OS — CID 50880111
N-[5,7-dimethyl-2-(2-propan-2-ylidenehydrazinyl)-1,3-benzothiazol-6-yl]-3-fluorobenzamide (PubChem CID 50880111) has the molecular formula C19H19FN4OS and a molecular weight of 370.45 g/mol. Its IUPAC name is N-[5,7-dimethyl-2-(2-propan-2-ylidenehydrazinyl)-1,3-benzothiazol-6-yl]-3-fluorobenzamide.
| Compound Name | N-[5,7-dimethyl-2-(2-propan-2-ylidenehydrazinyl)-1,3-benzothiazol-6-yl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 50880111 |
| Molecular Formula | C19H19FN4OS |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | N-[5,7-dimethyl-2-(2-propan-2-ylidenehydrazinyl)-1,3-benzothiazol-6-yl]-3-fluorobenzamide |
| SMILES | CC(C)=NNc1nc2cc(C)c(NC(=O)c3cccc(F)c3)c(C)c2s1 |
| InChI | InChI=1S/C19H19FN4OS/c1-10(2)23-24-19-21-15-8-11(3)16(12(4)17(15)26-19)22-18(25)13-6-5-7-14(20)9-13/h5-9H,1-4H3,(H,21,24)(H,22,25) |
| InChIKey | HWUHPISZINHDPW-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|