C24H24N4OS — CID 50880230
N-[2-[(2Z)-2-butan-2-ylidenehydrazinyl]-5,7-dimethyl-1,3-benzothiazol-6-yl]naphthalene-1-carboxamide (PubChem CID 50880230) has the molecular formula C24H24N4OS and a molecular weight of 416.55 g/mol. Its IUPAC name is N-[2-[(2Z)-2-butan-2-ylidenehydrazinyl]-5,7-dimethyl-1,3-benzothiazol-6-yl]naphthalene-1-carboxamide.
| Compound Name | N-[2-[(2Z)-2-butan-2-ylidenehydrazinyl]-5,7-dimethyl-1,3-benzothiazol-6-yl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 50880230 |
| Molecular Formula | C24H24N4OS |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | N-[2-[(2Z)-2-butan-2-ylidenehydrazinyl]-5,7-dimethyl-1,3-benzothiazol-6-yl]naphthalene-1-carboxamide |
| SMILES | CC/C(C)=N\Nc1nc2cc(C)c(NC(=O)c3cccc4ccccc34)c(C)c2s1 |
| InChI | InChI=1S/C24H24N4OS/c1-5-15(3)27-28-24-25-20-13-14(2)21(16(4)22(20)30-24)26-23(29)19-12-8-10-17-9-6-7-11-18(17)19/h6-13H,5H2,1-4H3,(H,25,28)(H,26,29)/b27-15- |
| InChIKey | AGRXUUFAMVJITA-DICXZTSXSA-N |
| XLogP | 6.52 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|