C23H27BrN4O2S — CID 95733279
2-(4-bromophenoxy)-N-[2-[(2E)-2-butan-2-ylidenehydrazinyl]-5,7-dimethyl-1,3-benzothiazol-6-yl]-2-methylpropanamide (PubChem CID 95733279) has the molecular formula C23H27BrN4O2S and a molecular weight of 503.47 g/mol. Its IUPAC name is 2-(4-bromophenoxy)-N-[2-[(2E)-2-butan-2-ylidenehydrazinyl]-5,7-dimethyl-1,3-benzothiazol-6-yl]-2-methylpropanamide.
| Compound Name | 2-(4-bromophenoxy)-N-[2-[(2E)-2-butan-2-ylidenehydrazinyl]-5,7-dimethyl-1,3-benzothiazol-6-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 95733279 |
| Molecular Formula | C23H27BrN4O2S |
| Molecular Weight | 503.47 g/mol |
| Exact Mass | 502.10 |
| IUPAC Name | 2-(4-bromophenoxy)-N-[2-[(2E)-2-butan-2-ylidenehydrazinyl]-5,7-dimethyl-1,3-benzothiazol-6-yl]-2-methylpropanamide |
| SMILES | CC/C(C)=N/Nc1nc2cc(C)c(NC(=O)C(C)(C)Oc3ccc(Br)cc3)c(C)c2s1 |
| InChI | InChI=1S/C23H27BrN4O2S/c1-7-14(3)27-28-22-25-18-12-13(2)19(15(4)20(18)31-22)26-21(29)23(5,6)30-17-10-8-16(24)9-11-17/h8-12H,7H2,1-6H3,(H,25,28)(H,26,29)/b27-14+ |
| InChIKey | XAIWYWSMKYNMNX-MZJWZYIUSA-N |
| XLogP | 6.67 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.47 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|