C22H24Cl2N4O2S — CID 95733266
N-[2-[(2E)-2-butan-2-ylidenehydrazinyl]-5,7-dimethyl-1,3-benzothiazol-6-yl]-2-(2,4-dichloro-6-methylphenoxy)acetamide (PubChem CID 95733266) has the molecular formula C22H24Cl2N4O2S and a molecular weight of 479.43 g/mol. Its IUPAC name is N-[2-[(2E)-2-butan-2-ylidenehydrazinyl]-5,7-dimethyl-1,3-benzothiazol-6-yl]-2-(2,4-dichloro-6-methylphenoxy)acetamide.
| Compound Name | N-[2-[(2E)-2-butan-2-ylidenehydrazinyl]-5,7-dimethyl-1,3-benzothiazol-6-yl]-2-(2,4-dichloro-6-methylphenoxy)acetamide |
|---|---|
| PubChem CID | 95733266 |
| Molecular Formula | C22H24Cl2N4O2S |
| Molecular Weight | 479.43 g/mol |
| Exact Mass | 478.10 |
| IUPAC Name | N-[2-[(2E)-2-butan-2-ylidenehydrazinyl]-5,7-dimethyl-1,3-benzothiazol-6-yl]-2-(2,4-dichloro-6-methylphenoxy)acetamide |
| SMILES | CC/C(C)=N/Nc1nc2cc(C)c(NC(=O)COc3c(C)cc(Cl)cc3Cl)c(C)c2s1 |
| InChI | InChI=1S/C22H24Cl2N4O2S/c1-6-13(4)27-28-22-25-17-8-11(2)19(14(5)21(17)31-22)26-18(29)10-30-20-12(3)7-15(23)9-16(20)24/h7-9H,6,10H2,1-5H3,(H,25,28)(H,26,29)/b27-13+ |
| InChIKey | PJAWYWRRMMDLDU-UVHMKAGCSA-N |
| XLogP | 6.74 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.43 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|