C23H28N4O2S — CID 50880959
N-[2-[(2Z)-2-butan-2-ylidenehydrazinyl]-5,7-dimethyl-1,3-benzothiazol-6-yl]-2-(3,5-dimethylphenoxy)acetamide (PubChem CID 50880959) has the molecular formula C23H28N4O2S and a molecular weight of 424.57 g/mol. Its IUPAC name is N-[2-[(2Z)-2-butan-2-ylidenehydrazinyl]-5,7-dimethyl-1,3-benzothiazol-6-yl]-2-(3,5-dimethylphenoxy)acetamide.
| Compound Name | N-[2-[(2Z)-2-butan-2-ylidenehydrazinyl]-5,7-dimethyl-1,3-benzothiazol-6-yl]-2-(3,5-dimethylphenoxy)acetamide |
|---|---|
| PubChem CID | 50880959 |
| Molecular Formula | C23H28N4O2S |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | N-[2-[(2Z)-2-butan-2-ylidenehydrazinyl]-5,7-dimethyl-1,3-benzothiazol-6-yl]-2-(3,5-dimethylphenoxy)acetamide |
| SMILES | CC/C(C)=N\Nc1nc2cc(C)c(NC(=O)COc3cc(C)cc(C)c3)c(C)c2s1 |
| InChI | InChI=1S/C23H28N4O2S/c1-7-16(5)26-27-23-24-19-11-15(4)21(17(6)22(19)30-23)25-20(28)12-29-18-9-13(2)8-14(3)10-18/h8-11H,7,12H2,1-6H3,(H,24,27)(H,25,28)/b26-16- |
| InChIKey | CLKVMPRBWFHLTI-QQXSKIMKSA-N |
| XLogP | 5.75 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|