C23H27ClN4O2S — CID 50880905
N-[2-[(2Z)-2-butan-2-ylidenehydrazinyl]-5,7-dimethyl-1,3-benzothiazol-6-yl]-2-(2-chloro-4,6-dimethylphenoxy)acetamide (PubChem CID 50880905) has the molecular formula C23H27ClN4O2S and a molecular weight of 459.02 g/mol. Its IUPAC name is N-[2-[(2Z)-2-butan-2-ylidenehydrazinyl]-5,7-dimethyl-1,3-benzothiazol-6-yl]-2-(2-chloro-4,6-dimethylphenoxy)acetamide.
| Compound Name | N-[2-[(2Z)-2-butan-2-ylidenehydrazinyl]-5,7-dimethyl-1,3-benzothiazol-6-yl]-2-(2-chloro-4,6-dimethylphenoxy)acetamide |
|---|---|
| PubChem CID | 50880905 |
| Molecular Formula | C23H27ClN4O2S |
| Molecular Weight | 459.02 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | N-[2-[(2Z)-2-butan-2-ylidenehydrazinyl]-5,7-dimethyl-1,3-benzothiazol-6-yl]-2-(2-chloro-4,6-dimethylphenoxy)acetamide |
| SMILES | CC/C(C)=N\Nc1nc2cc(C)c(NC(=O)COc3c(C)cc(C)cc3Cl)c(C)c2s1 |
| InChI | InChI=1S/C23H27ClN4O2S/c1-7-15(5)27-28-23-25-18-10-13(3)20(16(6)22(18)31-23)26-19(29)11-30-21-14(4)8-12(2)9-17(21)24/h8-10H,7,11H2,1-6H3,(H,25,28)(H,26,29)/b27-15- |
| InChIKey | PQFMLHPLZFDJKT-DICXZTSXSA-N |
| XLogP | 6.40 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.02 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|