C14H9N5O — CID 50888047
4-[(1Z)-3-amino-2,4,4-tricyanobuta-1,3-dienyl]benzamide (PubChem CID 50888047) has the molecular formula C14H9N5O and a molecular weight of 263.26 g/mol. Its IUPAC name is 4-[(1Z)-3-amino-2,4,4-tricyanobuta-1,3-dienyl]benzamide.
| Compound Name | 4-[(1Z)-3-amino-2,4,4-tricyanobuta-1,3-dienyl]benzamide |
|---|---|
| PubChem CID | 50888047 |
| Molecular Formula | C14H9N5O |
| Molecular Weight | 263.26 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | 4-[(1Z)-3-amino-2,4,4-tricyanobuta-1,3-dienyl]benzamide |
| SMILES | N#CC(C#N)=C(N)/C(C#N)=C/c1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C14H9N5O/c15-6-11(13(18)12(7-16)8-17)5-9-1-3-10(4-2-9)14(19)20/h1-5H,18H2,(H2,19,20)/b11-5+ |
| InChIKey | JVNJILLDUOLUBF-VZUCSPMQSA-N |
| XLogP | 0.95 |
| TPSA | 140.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.26 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|