C24H23N3O3S — CID 5089002
5-[4-(dimethylamino)phenyl]-4-[(2,5-dimethylphenyl)-hydroxymethylidene]-1-(1,3-thiazol-2-yl)pyrrolidine-2,3-dione (PubChem CID 5089002) has the molecular formula C24H23N3O3S and a molecular weight of 433.53 g/mol. Its IUPAC name is 5-[4-(dimethylamino)phenyl]-4-[(2,5-dimethylphenyl)-hydroxymethylidene]-1-(1,3-thiazol-2-yl)pyrrolidine-2,3-dione.
| Compound Name | 5-[4-(dimethylamino)phenyl]-4-[(2,5-dimethylphenyl)-hydroxymethylidene]-1-(1,3-thiazol-2-yl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 5089002 |
| Molecular Formula | C24H23N3O3S |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | 5-[4-(dimethylamino)phenyl]-4-[(2,5-dimethylphenyl)-hydroxymethylidene]-1-(1,3-thiazol-2-yl)pyrrolidine-2,3-dione |
| SMILES | Cc1ccc(C)c(C(O)=C2C(=O)C(=O)N(c3nccs3)C2c2ccc(N(C)C)cc2)c1 |
| InChI | InChI=1S/C24H23N3O3S/c1-14-5-6-15(2)18(13-14)21(28)19-20(16-7-9-17(10-8-16)26(3)4)27(23(30)22(19)29)24-25-11-12-31-24/h5-13,20,28H,1-4H3 |
| InChIKey | FIDLTGIWNCWJPS-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|